2,3,7,8-테트라클로로다이벤조다이옥신 문서 원본 보기

{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477210210
| ImageFile1=2,3,7,8-tetrachlorodibenzo(b,e)(1,4)dioxine 200.svg
| ImageFile2=Dioxin-3D-vdW.png
| PIN=2,3,7,8-Tetrachlorooxanthrene
| OtherNames=2,3,7,8-Tetrachlorodibenzo[''b'',''e''][1,4]dioxine<br />Tetradioxin<br />Tetrachlorodibenzodioxin<br />Tetrachlorodibenzo-''p''-dioxin
|Section1={{Chembox Identifiers
| Abbreviations = TCDD; TCDBD
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = DO80M48B6O
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 28119
| ChemSpiderID = 14865
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C07557
| InChI = 1/C12H4Cl4O2/c13-5-1-9-10(2-6(5)14)18-12-4-8(16)7(15)3-11(12)17-9/h1-4H
| InChIKey = HGUFODBRKLSHSI-UHFFFAOYAA
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 30327
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H4Cl4O2/c13-5-1-9-10(2-6(5)14)18-12-4-8(16)7(15)3-11(12)17-9/h1-4H
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = HGUFODBRKLSHSI-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=1746-01-6
| PubChem=15625
| SMILES = Clc2cc1Oc3c(Oc1cc2Cl)cc(Cl)c(Cl)c3
}}
|Section2={{Chembox Properties
| C=12 | H=4 | Cl=4 | O=2
| Appearance= Colorless to white crystalline solid<ref name=PGCH/>
| Density = 1.8 g/cm<sup>3</sup>
| MeltingPtC = 305
| BoilingPt=
| Solubility=0.2 µg/L<ref>{{저널 인용|doi=10.1021/es00171a006|author =Shiu WY|s2cid =53459209|title=Physical-chemical properties of chlorinated dibenzo-''p''-dioxins|journal=Environ Sci Technol|volume= 22|pages=651–658|year=1988|bibcode = 1988EnST...22..651S|issue=6|display-authors=etal}}</ref>
| LogP = 6.8
| VaporPressure = 1.5 × 10<sup>−9</sup> mmHg
 }}
|Section3={{Chembox Hazards
| GHSPictograms = {{GHS06}} {{GHS08}} {{GHS09}}
| GHSSignalWord = '''DANGER'''
| NFPA-H = 4
| NFPA-F = 1
| NFPA-R = 0
| NFPA-S =
| MainHazards= Developmental toxicant, Carcinogenic<ref name=PGCH/>
| FlashPtC = 164.2
| AutoignitionPtC =
| PEL = none<ref name=PGCH>{{PGCH|0594}}</ref>
| IDLH = N.D.<ref name=PGCH/>
| REL = Ca<ref name=PGCH/>
 }}
}}
'''2,3,7,8-테트라클로로다이벤조-p-다이옥신'''(2,3,7,8-Tetrachlorodibenzo-p-dioxin, TCDD)은 폴리클로린화 다이벤조-p-다이옥신이다. 이 계열 중 가장 약효가 강력한 화합물이며, [[베트남 전쟁]]에서 사용된 악명 높은 [[에이전트 오렌지]]의 오염물질로 알려져 있다.<ref>{{저널 인용|author1=Schecter A|author2=Birnbaum L|author3=Ryan JJ|author4=Constable JD |title=Dioxins: an overview |journal=Environ. Res. |volume=101 |issue=3 |pages=419–28 |year=2006 |pmid=16445906 |doi=10.1016/j.envres.2005.12.003|bibcode = 2006ER....101..419S }}</ref>

== 같이 보기 ==
{{위키공용분류}}
* [[발암물질 목록]]

== 각주 ==
{{각주}}

== 외부 링크 ==
* [http://chem.sis.nlm.nih.gov/chemidplus/direct.jsp?name=2,3,7,8-Tetrachlorodibenzodioxin&result=advanced U.S. National Library of Medicine: ChemIDplus – 2,3,7,8-Tetrachlorodibenzodioxin]
* [http://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+hsdb:@term+@na+@rel+2,3,7,8-TETRACHLORODIBENZO-P-DIOXIN U.S. National Library of Medicine: Hazardous Substances Databank – 2,3,7,8-Tetrachlorodibenzodioxin]
* [http://en.opasnet.org/w/Dioxin_synopsis Dioxin synopsis]
* [http://en.opasnet.org/w/Are_the_dioxins_the_most_dangerous_chemicals_in_our_environment%3F Dioxins] {{웹아카이브|url=https://web.archive.org/web/20201223094415/http://en.opasnet.org/w/Are_the_dioxins_the_most_dangerous_chemicals_in_our_environment%3F}}

{{전거 통제}}
{{위키데이터 속성 추적}}

[[분류:다이벤조다이옥신]]
[[분류:IARC 1군 발암 물질]]
[[분류:클로로아렌]]
[[분류:혈액 작용제]]